C18H25NO — CID 115782065
3-cyclohexyl-1-(5,6,7,8-tetrahydroquinolin-8-yl)propan-1-one (PubChem CID 115782065) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 3-cyclohexyl-1-(5,6,7,8-tetrahydroquinolin-8-yl)propan-1-one.
| Compound Name | 3-cyclohexyl-1-(5,6,7,8-tetrahydroquinolin-8-yl)propan-1-one |
|---|---|
| PubChem CID | 115782065 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 3-cyclohexyl-1-(5,6,7,8-tetrahydroquinolin-8-yl)propan-1-one |
| SMILES | O=C(CCC1CCCCC1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C18H25NO/c20-17(12-11-14-6-2-1-3-7-14)16-10-4-8-15-9-5-13-19-18(15)16/h5,9,13-14,16H,1-4,6-8,10-12H2 |
| InChIKey | RQRACLWJGIDJFQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |