C16H21NOS — CID 105114234
1-(5,6,7,8-tetrahydroquinolin-8-yl)-2-(thian-4-yl)ethanone (PubChem CID 105114234) has the molecular formula C16H21NOS and a molecular weight of 275.42 g/mol. Its IUPAC name is 1-(5,6,7,8-tetrahydroquinolin-8-yl)-2-(thian-4-yl)ethanone.
| Compound Name | 1-(5,6,7,8-tetrahydroquinolin-8-yl)-2-(thian-4-yl)ethanone |
|---|---|
| PubChem CID | 105114234 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-(5,6,7,8-tetrahydroquinolin-8-yl)-2-(thian-4-yl)ethanone |
| SMILES | O=C(CC1CCSCC1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C16H21NOS/c18-15(11-12-6-9-19-10-7-12)14-5-1-3-13-4-2-8-17-16(13)14/h2,4,8,12,14H,1,3,5-7,9-11H2 |
| InChIKey | RHSWVGDFVJDITE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |