C13H19N3S — CID 105322125
[6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl(thiolan-3-yl)methyl]hydrazine (PubChem CID 105322125) has the molecular formula C13H19N3S and a molecular weight of 249.38 g/mol. Its IUPAC name is [6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl(thiolan-3-yl)methyl]hydrazine.
| Compound Name | [6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl(thiolan-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105322125 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | [6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl(thiolan-3-yl)methyl]hydrazine |
| SMILES | NNC(C1CCSC1)C1CCc2cccnc21 |
| InChI | InChI=1S/C13H19N3S/c14-16-13(10-5-7-17-8-10)11-4-3-9-2-1-6-15-12(9)11/h1-2,6,10-11,13,16H,3-5,7-8,14H2 |
| InChIKey | ZDQJAKOREZSUES-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|