C17H25N3 — CID 105320985
[7-bicyclo[4.1.0]heptanyl(5,6,7,8-tetrahydroquinolin-8-yl)methyl]hydrazine (PubChem CID 105320985) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is [7-bicyclo[4.1.0]heptanyl(5,6,7,8-tetrahydroquinolin-8-yl)methyl]hydrazine.
| Compound Name | [7-bicyclo[4.1.0]heptanyl(5,6,7,8-tetrahydroquinolin-8-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105320985 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | [7-bicyclo[4.1.0]heptanyl(5,6,7,8-tetrahydroquinolin-8-yl)methyl]hydrazine |
| SMILES | NNC(C1CCCc2cccnc21)C1C2CCCCC21 |
| InChI | InChI=1S/C17H25N3/c18-20-17(15-12-7-1-2-8-13(12)15)14-9-3-5-11-6-4-10-19-16(11)14/h4,6,10,12-15,17,20H,1-3,5,7-9,18H2 |
| InChIKey | PKNFAPQVXGFXCT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|