C16H27N5 — CID 105247375
[(1,4-dimethylpiperazin-2-yl)-(5,6,7,8-tetrahydroquinolin-8-yl)methyl]hydrazine (PubChem CID 105247375) has the molecular formula C16H27N5 and a molecular weight of 289.43 g/mol. Its IUPAC name is [(1,4-dimethylpiperazin-2-yl)-(5,6,7,8-tetrahydroquinolin-8-yl)methyl]hydrazine.
| Compound Name | [(1,4-dimethylpiperazin-2-yl)-(5,6,7,8-tetrahydroquinolin-8-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105247375 |
| Molecular Formula | C16H27N5 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | [(1,4-dimethylpiperazin-2-yl)-(5,6,7,8-tetrahydroquinolin-8-yl)methyl]hydrazine |
| SMILES | CN1CCN(C)C(C(NN)C2CCCc3cccnc32)C1 |
| InChI | InChI=1S/C16H27N5/c1-20-9-10-21(2)14(11-20)16(19-17)13-7-3-5-12-6-4-8-18-15(12)13/h4,6,8,13-14,16,19H,3,5,7,9-11,17H2,1-2H3 |
| InChIKey | SVMYEUAQAXRQTG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|