C17H26N4 — CID 105265828
[6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]hydrazine (PubChem CID 105265828) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is [6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]hydrazine.
| Compound Name | [6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105265828 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | [6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]hydrazine |
| SMILES | CN1C2CCC1CC(C(NN)C1CCc3cccnc31)C2 |
| InChI | InChI=1S/C17H26N4/c1-21-13-5-6-14(21)10-12(9-13)17(20-18)15-7-4-11-3-2-8-19-16(11)15/h2-3,8,12-15,17,20H,4-7,9-10,18H2,1H3 |
| InChIKey | HDZHIOQZDBBYQQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|