C17H20ClN3 — CID 105195028
[2-(3-chlorophenyl)-1-(5,6,7,8-tetrahydroquinolin-8-yl)ethyl]hydrazine (PubChem CID 105195028) has the molecular formula C17H20ClN3 and a molecular weight of 301.82 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-1-(5,6,7,8-tetrahydroquinolin-8-yl)ethyl]hydrazine.
| Compound Name | [2-(3-chlorophenyl)-1-(5,6,7,8-tetrahydroquinolin-8-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105195028 |
| Molecular Formula | C17H20ClN3 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | [2-(3-chlorophenyl)-1-(5,6,7,8-tetrahydroquinolin-8-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1cccc(Cl)c1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C17H20ClN3/c18-14-7-1-4-12(10-14)11-16(21-19)15-8-2-5-13-6-3-9-20-17(13)15/h1,3-4,6-7,9-10,15-16,21H,2,5,8,11,19H2 |
| InChIKey | QKYJGZLXIIJGFC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|