C12H17ClN2 — CID 105195049
[2-(3-chlorophenyl)-1-cyclobutylethyl]hydrazine (PubChem CID 105195049) has the molecular formula C12H17ClN2 and a molecular weight of 224.74 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-1-cyclobutylethyl]hydrazine.
| Compound Name | [2-(3-chlorophenyl)-1-cyclobutylethyl]hydrazine |
|---|---|
| PubChem CID | 105195049 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.74 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | [2-(3-chlorophenyl)-1-cyclobutylethyl]hydrazine |
| SMILES | NNC(Cc1cccc(Cl)c1)C1CCC1 |
| InChI | InChI=1S/C12H17ClN2/c13-11-6-1-3-9(7-11)8-12(15-14)10-4-2-5-10/h1,3,6-7,10,12,15H,2,4-5,8,14H2 |
| InChIKey | RQGFPYSQCGIIHX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.74 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|