About 1-chloro-3-(2-methylpropyl)benzene;propan-2-ylcyclobutane
1-chloro-3-(2-methylpropyl)benzene;propan-2-ylcyclobutane (PubChem CID 163536568) has the molecular formula C17H27Cl
and a molecular weight of 266.86 g/mol. Its IUPAC name is 1-chloro-3-(2-methylpropyl)benzene;propan-2-ylcyclobutane.
Molecular Properties
| Compound Name | 1-chloro-3-(2-methylpropyl)benzene;propan-2-ylcyclobutane |
| PubChem CID | 163536568 |
| Molecular Formula | C17H27Cl |
| Molecular Weight | 266.86 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 1-chloro-3-(2-methylpropyl)benzene;propan-2-ylcyclobutane |
| SMILES | CC(C)C1CCC1.CC(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C10H13Cl.C7H14/c1-8(2)6-9-4-3-5-10(11)7-9;1-6(2)7-4-3-5-7/h3-5,7-8H,6H2,1-2H3;6-7H,3-5H2,1-2H3 |
| InChIKey | DXMKCHJXCBOVDY-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.86 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-3-(2-methylpropyl)benzene;propan-2-ylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-(2-methylpropyl)benzene;propan-2-ylcyclobutane?
The IUPAC name of 1-chloro-3-(2-methylpropyl)benzene;propan-2-ylcyclobutane (CID 163536568) is 1-chloro-3-(2-methylpropyl)benzene;propan-2-ylcyclobutane.
What is the SMILES notation for 1-chloro-3-(2-methylpropyl)benzene;propan-2-ylcyclobutane?
The canonical SMILES for 1-chloro-3-(2-methylpropyl)benzene;propan-2-ylcyclobutane is CC(C)C1CCC1.CC(C)Cc1cccc(Cl)c1.
What is the InChIKey of 1-chloro-3-(2-methylpropyl)benzene;propan-2-ylcyclobutane?
The InChIKey is DXMKCHJXCBOVDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Cl.C7H14/c1-8(2)6-9-4-3-5-10(11)7-9;1-6(2)7-4-3-5-7/h3-5,7-8H,6H2,1-2H3;6-7H,3-5H2,1-2H3.
What are the key properties of 1-chloro-3-(2-methylpropyl)benzene;propan-2-ylcyclobutane?
1-chloro-3-(2-methylpropyl)benzene;propan-2-ylcyclobutane has a molecular weight of 266.86 g/mol, XLogP of 5.98, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-(2-methylpropyl)benzene;propan-2-ylcyclobutane is sourced from PubChem (CID 163536568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).