C14H20 — CID 169137072
1-cyclobutyl-3-(2-methylpropyl)benzene (PubChem CID 169137072) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 1-cyclobutyl-3-(2-methylpropyl)benzene.
| Compound Name | 1-cyclobutyl-3-(2-methylpropyl)benzene |
|---|---|
| PubChem CID | 169137072 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 1-cyclobutyl-3-(2-methylpropyl)benzene |
| SMILES | CC(C)Cc1cccc(C2CCC2)c1 |
| InChI | InChI=1S/C14H20/c1-11(2)9-12-5-3-8-14(10-12)13-6-4-7-13/h3,5,8,10-11,13H,4,6-7,9H2,1-2H3 |
| InChIKey | ZPXUZXFKFBMREB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |