C15H20O — CID 112705489
2-[3-(2-methylpropyl)phenyl]cyclopentan-1-one (PubChem CID 112705489) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-[3-(2-methylpropyl)phenyl]cyclopentan-1-one.
| Compound Name | 2-[3-(2-methylpropyl)phenyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 112705489 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2-[3-(2-methylpropyl)phenyl]cyclopentan-1-one |
| SMILES | CC(C)Cc1cccc(C2CCCC2=O)c1 |
| InChI | InChI=1S/C15H20O/c1-11(2)9-12-5-3-6-13(10-12)14-7-4-8-15(14)16/h3,5-6,10-11,14H,4,7-9H2,1-2H3 |
| InChIKey | MHWXQAQZPNNLNN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |