C14H16O4 — CID 70132964
3,4-dihydroxy-2-[3-(2-methylpropyl)phenyl]-2H-furan-5-one (PubChem CID 70132964) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3,4-dihydroxy-2-[3-(2-methylpropyl)phenyl]-2H-furan-5-one.
| Compound Name | 3,4-dihydroxy-2-[3-(2-methylpropyl)phenyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 70132964 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3,4-dihydroxy-2-[3-(2-methylpropyl)phenyl]-2H-furan-5-one |
| SMILES | CC(C)Cc1cccc(C2OC(=O)C(O)=C2O)c1 |
| InChI | InChI=1S/C14H16O4/c1-8(2)6-9-4-3-5-10(7-9)13-11(15)12(16)14(17)18-13/h3-5,7-8,13,15-16H,6H2,1-2H3 |
| InChIKey | ITWSGOSJXYBLOO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |