C19H29N — CID 59601190
2-[3-(2-methylpropyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline (PubChem CID 59601190) has the molecular formula C19H29N and a molecular weight of 271.45 g/mol. Its IUPAC name is 2-[3-(2-methylpropyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline.
| Compound Name | 2-[3-(2-methylpropyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
|---|---|
| PubChem CID | 59601190 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 2-[3-(2-methylpropyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
| SMILES | CC(C)Cc1cccc(C2CCC3CCCCC3N2)c1 |
| InChI | InChI=1S/C19H29N/c1-14(2)12-15-6-5-8-17(13-15)19-11-10-16-7-3-4-9-18(16)20-19/h5-6,8,13-14,16,18-20H,3-4,7,9-12H2,1-2H3 |
| InChIKey | VPRAHGKWEPHXLU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |