C18H25N — CID 116506722
2-(4-cyclobutylphenyl)-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridine (PubChem CID 116506722) has the molecular formula C18H25N and a molecular weight of 255.41 g/mol. Its IUPAC name is 2-(4-cyclobutylphenyl)-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridine.
| Compound Name | 2-(4-cyclobutylphenyl)-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridine |
|---|---|
| PubChem CID | 116506722 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 2-(4-cyclobutylphenyl)-2,3,4,4a,5,6,7,7a-octahydro-1H-cyclopenta[b]pyridine |
| SMILES | c1cc(C2CCC3CCCC3N2)ccc1C1CCC1 |
| InChI | InChI=1S/C18H25N/c1-3-13(4-1)14-7-9-16(10-8-14)18-12-11-15-5-2-6-17(15)19-18/h7-10,13,15,17-19H,1-6,11-12H2 |
| InChIKey | QQXUUQAFTVTEEK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |