C17H21N3 — CID 105322018
[6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl-(2,5-dimethylphenyl)methyl]hydrazine (PubChem CID 105322018) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is [6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl-(2,5-dimethylphenyl)methyl]hydrazine.
| Compound Name | [6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl-(2,5-dimethylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105322018 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | [6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl-(2,5-dimethylphenyl)methyl]hydrazine |
| SMILES | Cc1ccc(C)c(C(NN)C2CCc3cccnc32)c1 |
| InChI | InChI=1S/C17H21N3/c1-11-5-6-12(2)15(10-11)17(20-18)14-8-7-13-4-3-9-19-16(13)14/h3-6,9-10,14,17,20H,7-8,18H2,1-2H3 |
| InChIKey | BFSRHIUVUDWTHR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|