C17H20BrN3 — CID 107986108
[(2-bromo-3-methylphenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methyl]hydrazine (PubChem CID 107986108) has the molecular formula C17H20BrN3 and a molecular weight of 346.27 g/mol. Its IUPAC name is [(2-bromo-3-methylphenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methyl]hydrazine.
| Compound Name | [(2-bromo-3-methylphenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107986108 |
| Molecular Formula | C17H20BrN3 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | [(2-bromo-3-methylphenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methyl]hydrazine |
| SMILES | Cc1cccc(C(NN)C2CCCc3cccnc32)c1Br |
| InChI | InChI=1S/C17H20BrN3/c1-11-5-2-8-13(15(11)18)17(21-19)14-9-3-6-12-7-4-10-20-16(12)14/h2,4-5,7-8,10,14,17,21H,3,6,9,19H2,1H3 |
| InChIKey | BPISFGZMCWUEFM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|