C16H17ClFN3 — CID 105215470
[(2-chloro-4-fluorophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methyl]hydrazine (PubChem CID 105215470) has the molecular formula C16H17ClFN3 and a molecular weight of 305.78 g/mol. Its IUPAC name is [(2-chloro-4-fluorophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methyl]hydrazine.
| Compound Name | [(2-chloro-4-fluorophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105215470 |
| Molecular Formula | C16H17ClFN3 |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | [(2-chloro-4-fluorophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methyl]hydrazine |
| SMILES | NNC(c1ccc(F)cc1Cl)C1CCCc2cccnc21 |
| InChI | InChI=1S/C16H17ClFN3/c17-14-9-11(18)6-7-12(14)16(21-19)13-5-1-3-10-4-2-8-20-15(10)13/h2,4,6-9,13,16,21H,1,3,5,19H2 |
| InChIKey | HUZYEAYTSSEQRT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|