C15H16IN3 — CID 105321973
[6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl-(3-iodophenyl)methyl]hydrazine (PubChem CID 105321973) has the molecular formula C15H16IN3 and a molecular weight of 365.22 g/mol. Its IUPAC name is [6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl-(3-iodophenyl)methyl]hydrazine.
| Compound Name | [6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl-(3-iodophenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105321973 |
| Molecular Formula | C15H16IN3 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | [6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl-(3-iodophenyl)methyl]hydrazine |
| SMILES | NNC(c1cccc(I)c1)C1CCc2cccnc21 |
| InChI | InChI=1S/C15H16IN3/c16-12-5-1-3-11(9-12)15(19-17)13-7-6-10-4-2-8-18-14(10)13/h1-5,8-9,13,15,19H,6-7,17H2 |
| InChIKey | VAOJRLIRAHVZIR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|