C13H14BrN3S — CID 105222197
[(5-bromothiophen-2-yl)-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)methyl]hydrazine (PubChem CID 105222197) has the molecular formula C13H14BrN3S and a molecular weight of 324.25 g/mol. Its IUPAC name is [(5-bromothiophen-2-yl)-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)methyl]hydrazine.
| Compound Name | [(5-bromothiophen-2-yl)-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105222197 |
| Molecular Formula | C13H14BrN3S |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | [(5-bromothiophen-2-yl)-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)methyl]hydrazine |
| SMILES | NNC(c1ccc(Br)s1)C1CCc2cccnc21 |
| InChI | InChI=1S/C13H14BrN3S/c14-11-6-5-10(18-11)13(17-15)9-4-3-8-2-1-7-16-12(8)9/h1-2,5-7,9,13,17H,3-4,15H2 |
| InChIKey | BFERHSMFLNWYHY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|