C12H16N6 — CID 105231222
4-[6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl(hydrazinyl)methyl]-1H-pyrazol-5-amine (PubChem CID 105231222) has the molecular formula C12H16N6 and a molecular weight of 244.30 g/mol. Its IUPAC name is 4-[6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl(hydrazinyl)methyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl(hydrazinyl)methyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 105231222 |
| Molecular Formula | C12H16N6 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 4-[6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl(hydrazinyl)methyl]-1H-pyrazol-5-amine |
| SMILES | NNC(c1cn[nH]c1N)C1CCc2cccnc21 |
| InChI | InChI=1S/C12H16N6/c13-12-9(6-16-18-12)11(17-14)8-4-3-7-2-1-5-15-10(7)8/h1-2,5-6,8,11,17H,3-4,14H2,(H3,13,16,18) |
| InChIKey | PJCAKJISQOWTJP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|