C19H31NO2Si — CID 67438705
(9S)-9-tri(propan-2-yl)silyloxy-5,7,8,9-tetrahydrocyclohepta[b]pyridin-6-one (PubChem CID 67438705) has the molecular formula C19H31NO2Si and a molecular weight of 333.55 g/mol. Its IUPAC name is (9S)-9-tri(propan-2-yl)silyloxy-5,7,8,9-tetrahydrocyclohepta[b]pyridin-6-one.
| Compound Name | (9S)-9-tri(propan-2-yl)silyloxy-5,7,8,9-tetrahydrocyclohepta[b]pyridin-6-one |
|---|---|
| PubChem CID | 67438705 |
| Molecular Formula | C19H31NO2Si |
| Molecular Weight | 333.55 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (9S)-9-tri(propan-2-yl)silyloxy-5,7,8,9-tetrahydrocyclohepta[b]pyridin-6-one |
| SMILES | CC(C)[Si](O[C@H]1CCC(=O)Cc2cccnc21)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H31NO2Si/c1-13(2)23(14(3)4,15(5)6)22-18-10-9-17(21)12-16-8-7-11-20-19(16)18/h7-8,11,13-15,18H,9-10,12H2,1-6H3/t18-/m0/s1 |
| InChIKey | CCUQXJROYWCJQG-SFHVURJKSA-N |
| XLogP | 5.22 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|