C20H33NO2Si — CID 175403309
9-tri(propan-2-yl)silyloxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-5-carbaldehyde (PubChem CID 175403309) has the molecular formula C20H33NO2Si and a molecular weight of 347.58 g/mol. Its IUPAC name is 9-tri(propan-2-yl)silyloxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-5-carbaldehyde.
| Compound Name | 9-tri(propan-2-yl)silyloxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-5-carbaldehyde |
|---|---|
| PubChem CID | 175403309 |
| Molecular Formula | C20H33NO2Si |
| Molecular Weight | 347.58 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | 9-tri(propan-2-yl)silyloxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-5-carbaldehyde |
| SMILES | CC(C)[Si](OC1CCCC(C=O)c2cccnc21)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H33NO2Si/c1-14(2)24(15(3)4,16(5)6)23-19-11-7-9-17(13-22)18-10-8-12-21-20(18)19/h8,10,12-17,19H,7,9,11H2,1-6H3 |
| InChIKey | LDRKBBIMCWWPKT-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.58 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|