C16H24N2 — CID 79737614
N-propan-2-yl-4-(5,6,7,8-tetrahydroquinolin-8-yl)but-3-en-1-amine (PubChem CID 79737614) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is N-propan-2-yl-4-(5,6,7,8-tetrahydroquinolin-8-yl)but-3-en-1-amine.
| Compound Name | N-propan-2-yl-4-(5,6,7,8-tetrahydroquinolin-8-yl)but-3-en-1-amine |
|---|---|
| PubChem CID | 79737614 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N-propan-2-yl-4-(5,6,7,8-tetrahydroquinolin-8-yl)but-3-en-1-amine |
| SMILES | CC(C)NCCC=CC1CCCc2cccnc21 |
| InChI | InChI=1S/C16H24N2/c1-13(2)17-11-4-3-7-14-8-5-9-15-10-6-12-18-16(14)15/h3,6-7,10,12-14,17H,4-5,8-9,11H2,1-2H3 |
| InChIKey | LRAFJDXCKXGEFW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|