C13H17N — CID 67125733
8-[(E)-but-2-enyl]-5,6,7,8-tetrahydroquinoline (PubChem CID 67125733) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 8-[(E)-but-2-enyl]-5,6,7,8-tetrahydroquinoline.
| Compound Name | 8-[(E)-but-2-enyl]-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 67125733 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 8-[(E)-but-2-enyl]-5,6,7,8-tetrahydroquinoline |
| SMILES | C/C=C/CC1CCCc2cccnc21 |
| InChI | InChI=1S/C13H17N/c1-2-3-6-11-7-4-8-12-9-5-10-14-13(11)12/h2-3,5,9-11H,4,6-8H2,1H3/b3-2+ |
| InChIKey | PEXHUEDSULPQLI-NSCUHMNNSA-N |
| XLogP | 3.47 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|