C9H12N2 — CID 12031071
(8S)-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 12031071) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is (8S)-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | (8S)-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 12031071 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (8S)-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | N[C@H]1CCCc2cccnc21 |
| InChI | InChI=1S/C9H12N2/c10-8-5-1-3-7-4-2-6-11-9(7)8/h2,4,6,8H,1,3,5,10H2/t8-/m0/s1 |
| InChIKey | JQGOUNFVDYUKMM-QMMMGPOBSA-N |
| XLogP | 1.42 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |