C9H10FN — CID 164583093
(8S)-8-fluoro-5,6,7,8-tetrahydroquinoline (PubChem CID 164583093) has the molecular formula C9H10FN and a molecular weight of 151.18 g/mol. Its IUPAC name is (8S)-8-fluoro-5,6,7,8-tetrahydroquinoline.
| Compound Name | (8S)-8-fluoro-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 164583093 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | (8S)-8-fluoro-5,6,7,8-tetrahydroquinoline |
| SMILES | F[C@H]1CCCc2cccnc21 |
| InChI | InChI=1S/C9H10FN/c10-8-5-1-3-7-4-2-6-11-9(7)8/h2,4,6,8H,1,3,5H2/t8-/m0/s1 |
| InChIKey | SJHZORODEVZIEW-QMMMGPOBSA-N |
| XLogP | 2.43 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |