C10H15N3 — CID 105220811
5,6,7,8-tetrahydroquinolin-8-ylmethylhydrazine (PubChem CID 105220811) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 5,6,7,8-tetrahydroquinolin-8-ylmethylhydrazine.
| Compound Name | 5,6,7,8-tetrahydroquinolin-8-ylmethylhydrazine |
|---|---|
| PubChem CID | 105220811 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 5,6,7,8-tetrahydroquinolin-8-ylmethylhydrazine |
| SMILES | NNCC1CCCc2cccnc21 |
| InChI | InChI=1S/C10H15N3/c11-13-7-9-4-1-3-8-5-2-6-12-10(8)9/h2,5-6,9,13H,1,3-4,7,11H2 |
| InChIKey | DPBGDZCEWPOBOQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|