C9H11FN2 — CID 145471491
N-fluoro-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 145471491) has the molecular formula C9H11FN2 and a molecular weight of 166.20 g/mol. Its IUPAC name is N-fluoro-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-fluoro-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 145471491 |
| Molecular Formula | C9H11FN2 |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | N-fluoro-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | FNC1CCCc2cccnc21 |
| InChI | InChI=1S/C9H11FN2/c10-12-8-5-1-3-7-4-2-6-11-9(7)8/h2,4,6,8,12H,1,3,5H2 |
| InChIKey | RJJUYGBXPGOYAV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|