C13H20N2O2 — CID 79080071
N-(2,2-dimethoxyethyl)-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 79080071) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 79080071 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | COC(CNC1CCCc2cccnc21)OC |
| InChI | InChI=1S/C13H20N2O2/c1-16-12(17-2)9-15-11-7-3-5-10-6-4-8-14-13(10)11/h4,6,8,11-12,15H,3,5,7,9H2,1-2H3 |
| InChIKey | FIHJZHZBYPSJMC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|