C13H20N2O — CID 102695976
N-(2-methoxypropyl)-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 102695976) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is N-(2-methoxypropyl)-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-(2-methoxypropyl)-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 102695976 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | N-(2-methoxypropyl)-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | COC(C)CNC1CCCc2cccnc21 |
| InChI | InChI=1S/C13H20N2O/c1-10(16-2)9-15-12-7-3-5-11-6-4-8-14-13(11)12/h4,6,8,10,12,15H,3,5,7,9H2,1-2H3 |
| InChIKey | RVVIXIMAURZHAS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |