C14H22N2O — CID 79080089
3-methyl-4-(5,6,7,8-tetrahydroquinolin-8-ylamino)butan-1-ol (PubChem CID 79080089) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 3-methyl-4-(5,6,7,8-tetrahydroquinolin-8-ylamino)butan-1-ol.
| Compound Name | 3-methyl-4-(5,6,7,8-tetrahydroquinolin-8-ylamino)butan-1-ol |
|---|---|
| PubChem CID | 79080089 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 3-methyl-4-(5,6,7,8-tetrahydroquinolin-8-ylamino)butan-1-ol |
| SMILES | CC(CCO)CNC1CCCc2cccnc21 |
| InChI | InChI=1S/C14H22N2O/c1-11(7-9-17)10-16-13-6-2-4-12-5-3-8-15-14(12)13/h3,5,8,11,13,16-17H,2,4,6-7,9-10H2,1H3 |
| InChIKey | CDRXEUXZDHBEQU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |