C13H18N2 — CID 114615760
N-(2-methylprop-2-enyl)-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 114615760) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N-(2-methylprop-2-enyl)-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-(2-methylprop-2-enyl)-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 114615760 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | N-(2-methylprop-2-enyl)-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | C=C(C)CNC1CCCc2cccnc21 |
| InChI | InChI=1S/C13H18N2/c1-10(2)9-15-12-7-3-5-11-6-4-8-14-13(11)12/h4,6,8,12,15H,1,3,5,7,9H2,2H3 |
| InChIKey | SUFCWWGCVZBDPZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|