C16H18N2 — CID 11736560
(8S)-N-benzyl-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 11736560) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is (8S)-N-benzyl-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | (8S)-N-benzyl-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 11736560 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (8S)-N-benzyl-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | c1ccc(CN[C@H]2CCCc3cccnc32)cc1 |
| InChI | InChI=1S/C16H18N2/c1-2-6-13(7-3-1)12-18-15-10-4-8-14-9-5-11-17-16(14)15/h1-3,5-7,9,11,15,18H,4,8,10,12H2/t15-/m0/s1 |
| InChIKey | RBFICQOQWHLHFA-HNNXBMFYSA-N |
| XLogP | 3.25 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |