C23H25N3O2S — CID 59826223
N-benzyl-3-[(5,6,7,8-tetrahydroquinolin-8-ylamino)methyl]benzenesulfonamide (PubChem CID 59826223) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is N-benzyl-3-[(5,6,7,8-tetrahydroquinolin-8-ylamino)methyl]benzenesulfonamide.
| Compound Name | N-benzyl-3-[(5,6,7,8-tetrahydroquinolin-8-ylamino)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59826223 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | N-benzyl-3-[(5,6,7,8-tetrahydroquinolin-8-ylamino)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccccc1)c1cccc(CNC2CCCc3cccnc32)c1 |
| InChI | InChI=1S/C23H25N3O2S/c27-29(28,26-17-18-7-2-1-3-8-18)21-12-4-9-19(15-21)16-25-22-13-5-10-20-11-6-14-24-23(20)22/h1-4,6-9,11-12,14-15,22,25-26H,5,10,13,16-17H2 |
| InChIKey | WZQFSTDKVUSULN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |