C18H31N3 — CID 79079669
3-ethyl-2-N,2-N-dimethyl-1-N-(5,6,7,8-tetrahydroquinolin-8-yl)pentane-1,2-diamine (PubChem CID 79079669) has the molecular formula C18H31N3 and a molecular weight of 289.47 g/mol. Its IUPAC name is 3-ethyl-2-N,2-N-dimethyl-1-N-(5,6,7,8-tetrahydroquinolin-8-yl)pentane-1,2-diamine.
| Compound Name | 3-ethyl-2-N,2-N-dimethyl-1-N-(5,6,7,8-tetrahydroquinolin-8-yl)pentane-1,2-diamine |
|---|---|
| PubChem CID | 79079669 |
| Molecular Formula | C18H31N3 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | 3-ethyl-2-N,2-N-dimethyl-1-N-(5,6,7,8-tetrahydroquinolin-8-yl)pentane-1,2-diamine |
| SMILES | CCC(CC)C(CNC1CCCc2cccnc21)N(C)C |
| InChI | InChI=1S/C18H31N3/c1-5-14(6-2)17(21(3)4)13-20-16-11-7-9-15-10-8-12-19-18(15)16/h8,10,12,14,16-17,20H,5-7,9,11,13H2,1-4H3 |
| InChIKey | VNVOLSDLGZSSER-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |