C16H18N2S — CID 79079351
N-(2-methylsulfanylphenyl)-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 79079351) has the molecular formula C16H18N2S and a molecular weight of 270.40 g/mol. Its IUPAC name is N-(2-methylsulfanylphenyl)-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-(2-methylsulfanylphenyl)-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 79079351 |
| Molecular Formula | C16H18N2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N-(2-methylsulfanylphenyl)-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | CSc1ccccc1NC1CCCc2cccnc21 |
| InChI | InChI=1S/C16H18N2S/c1-19-15-10-3-2-8-13(15)18-14-9-4-6-12-7-5-11-17-16(12)14/h2-3,5,7-8,10-11,14,18H,4,6,9H2,1H3 |
| InChIKey | UFGYSHRKXQYGIX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |