C15H14F2N2 — CID 79079820
N-(2,5-difluorophenyl)-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 79079820) has the molecular formula C15H14F2N2 and a molecular weight of 260.29 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-(2,5-difluorophenyl)-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 79079820 |
| Molecular Formula | C15H14F2N2 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-(2,5-difluorophenyl)-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | Fc1ccc(F)c(NC2CCCc3cccnc32)c1 |
| InChI | InChI=1S/C15H14F2N2/c16-11-6-7-12(17)14(9-11)19-13-5-1-3-10-4-2-8-18-15(10)13/h2,4,6-9,13,19H,1,3,5H2 |
| InChIKey | UYLXATDMVHVQSQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |