C16H15FN2O2 — CID 79079889
4-fluoro-3-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzoic acid (PubChem CID 79079889) has the molecular formula C16H15FN2O2 and a molecular weight of 286.31 g/mol. Its IUPAC name is 4-fluoro-3-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzoic acid.
| Compound Name | 4-fluoro-3-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzoic acid |
|---|---|
| PubChem CID | 79079889 |
| Molecular Formula | C16H15FN2O2 |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-fluoro-3-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(F)c(NC2CCCc3cccnc32)c1 |
| InChI | InChI=1S/C16H15FN2O2/c17-12-7-6-11(16(20)21)9-14(12)19-13-5-1-3-10-4-2-8-18-15(10)13/h2,4,6-9,13,19H,1,3,5H2,(H,20,21) |
| InChIKey | JQLASJWQFQFXKU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |