4-fluoro-3-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzoic acid

C16H15FN2O2 — CID 79079889

IUPAC4-fluoro-3-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzoic acid
SMILESO=C(O)c1ccc(F)c(NC2CCCc3cccnc32)c1
InChIInChI=1S/C16H15FN2O2/c17-12-7-6-11(16(20)21)9-14(12)19-13-5-1-3-10-4-2-8-18-15(10)13/h2,4,6-9,13,19H,1,3,5H2,(H,20,21)
InChIKeyJQLASJWQFQFXKU-UHFFFAOYSA-N
MW286.31 g/mol
LogP3.41
Rot. Bonds3

About 4-fluoro-3-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzoic acid

4-fluoro-3-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzoic acid (PubChem CID 79079889) has the molecular formula C16H15FN2O2 and a molecular weight of 286.31 g/mol. Its IUPAC name is 4-fluoro-3-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzoic acid.

Molecular Properties

Compound Name4-fluoro-3-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzoic acid
PubChem CID79079889
Molecular FormulaC16H15FN2O2
Molecular Weight286.31 g/mol
Exact Mass286.11
IUPAC Name4-fluoro-3-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzoic acid
SMILESO=C(O)c1ccc(F)c(NC2CCCc3cccnc32)c1
InChIInChI=1S/C16H15FN2O2/c17-12-7-6-11(16(20)21)9-14(12)19-13-5-1-3-10-4-2-8-18-15(10)13/h2,4,6-9,13,19H,1,3,5H2,(H,20,21)
InChIKeyJQLASJWQFQFXKU-UHFFFAOYSA-N
XLogP3.41
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.31
LogP ≤ 53.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-fluoro-3-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-fluoro-3-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzoic acid?
The IUPAC name of 4-fluoro-3-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzoic acid (CID 79079889) is 4-fluoro-3-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzoic acid.
What is the SMILES notation for 4-fluoro-3-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzoic acid?
The canonical SMILES for 4-fluoro-3-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzoic acid is O=C(O)c1ccc(F)c(NC2CCCc3cccnc32)c1.
What is the InChIKey of 4-fluoro-3-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzoic acid?
The InChIKey is JQLASJWQFQFXKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15FN2O2/c17-12-7-6-11(16(20)21)9-14(12)19-13-5-1-3-10-4-2-8-18-15(10)13/h2,4,6-9,13,19H,1,3,5H2,(H,20,21).
What are the key properties of 4-fluoro-3-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzoic acid?
4-fluoro-3-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzoic acid has a molecular weight of 286.31 g/mol, XLogP of 3.41, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3-(5,6,7,8-tetrahydroquinolin-8-ylamino)benzoic acid is sourced from PubChem (CID 79079889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).