C16H17IN2 — CID 79079954
N-(4-iodo-2-methylphenyl)-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 79079954) has the molecular formula C16H17IN2 and a molecular weight of 364.23 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-(4-iodo-2-methylphenyl)-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 79079954 |
| Molecular Formula | C16H17IN2 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | Cc1cc(I)ccc1NC1CCCc2cccnc21 |
| InChI | InChI=1S/C16H17IN2/c1-11-10-13(17)7-8-14(11)19-15-6-2-4-12-5-3-9-18-16(12)15/h3,5,7-10,15,19H,2,4,6H2,1H3 |
| InChIKey | RIPDOSLUYNQIQY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|