C14H12BrIN2 — CID 114259315
N-(5-bromo-2-iodophenyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine (PubChem CID 114259315) has the molecular formula C14H12BrIN2 and a molecular weight of 415.07 g/mol. Its IUPAC name is N-(5-bromo-2-iodophenyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine.
| Compound Name | N-(5-bromo-2-iodophenyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine |
|---|---|
| PubChem CID | 114259315 |
| Molecular Formula | C14H12BrIN2 |
| Molecular Weight | 415.07 g/mol |
| Exact Mass | 413.92 |
| IUPAC Name | N-(5-bromo-2-iodophenyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine |
| SMILES | Brc1ccc(I)c(NC2CCc3cccnc32)c1 |
| InChI | InChI=1S/C14H12BrIN2/c15-10-4-5-11(16)13(8-10)18-12-6-3-9-2-1-7-17-14(9)12/h1-2,4-5,7-8,12,18H,3,6H2 |
| InChIKey | ULQDQSAXFZVWKI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.07 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|