C18H24N2 — CID 102773161
N-(2-adamantyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine (PubChem CID 102773161) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is N-(2-adamantyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine.
| Compound Name | N-(2-adamantyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine |
|---|---|
| PubChem CID | 102773161 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | N-(2-adamantyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine |
| SMILES | c1cnc2c(c1)CCC2NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H24N2/c1-2-13-3-4-16(18(13)19-5-1)20-17-14-7-11-6-12(9-14)10-15(17)8-11/h1-2,5,11-12,14-17,20H,3-4,6-10H2 |
| InChIKey | LWWVIVKVHXBTDJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |