C12H14N2 — CID 102773823
N-but-3-ynyl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine (PubChem CID 102773823) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is N-but-3-ynyl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine.
| Compound Name | N-but-3-ynyl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine |
|---|---|
| PubChem CID | 102773823 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | N-but-3-ynyl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-amine |
| SMILES | C#CCCNC1CCc2cccnc21 |
| InChI | InChI=1S/C12H14N2/c1-2-3-8-13-11-7-6-10-5-4-9-14-12(10)11/h1,4-5,9,11,13H,3,6-8H2 |
| InChIKey | ZLGFGOCGXLGVEC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|