C16H25N3 — CID 79080172
N-(3-pyrrolidin-1-ylpropyl)-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 79080172) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is N-(3-pyrrolidin-1-ylpropyl)-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-(3-pyrrolidin-1-ylpropyl)-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 79080172 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | N-(3-pyrrolidin-1-ylpropyl)-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | c1cnc2c(c1)CCCC2NCCCN1CCCC1 |
| InChI | InChI=1S/C16H25N3/c1-2-12-19(11-1)13-5-10-17-15-8-3-6-14-7-4-9-18-16(14)15/h4,7,9,15,17H,1-3,5-6,8,10-13H2 |
| InChIKey | YMDCRGOBMMECLV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|