C15H25N3 — CID 142667915
N'-(5,6,7,8-tetrahydroquinolin-8-yl)hexane-1,6-diamine (PubChem CID 142667915) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is N'-(5,6,7,8-tetrahydroquinolin-8-yl)hexane-1,6-diamine.
| Compound Name | N'-(5,6,7,8-tetrahydroquinolin-8-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 142667915 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | N'-(5,6,7,8-tetrahydroquinolin-8-yl)hexane-1,6-diamine |
| SMILES | NCCCCCCNC1CCCc2cccnc21 |
| InChI | InChI=1S/C15H25N3/c16-10-3-1-2-4-11-17-14-9-5-7-13-8-6-12-18-15(13)14/h6,8,12,14,17H,1-5,7,9-11,16H2 |
| InChIKey | KBVJBIGXLCHNJP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|