C19H31N3O2 — CID 91500558
5-(5,6,7,8-tetrahydroquinolin-8-ylamino)pentyl N-tert-butylcarbamate (PubChem CID 91500558) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 5-(5,6,7,8-tetrahydroquinolin-8-ylamino)pentyl N-tert-butylcarbamate.
| Compound Name | 5-(5,6,7,8-tetrahydroquinolin-8-ylamino)pentyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 91500558 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | 5-(5,6,7,8-tetrahydroquinolin-8-ylamino)pentyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCCCCCNC1CCCc2cccnc21 |
| InChI | InChI=1S/C19H31N3O2/c1-19(2,3)22-18(23)24-14-6-4-5-12-20-16-11-7-9-15-10-8-13-21-17(15)16/h8,10,13,16,20H,4-7,9,11-12,14H2,1-3H3,(H,22,23) |
| InChIKey | LMXOJAMMKZMRLE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|