C15H20N2 — CID 114158536
N-hex-5-ynyl-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 114158536) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N-hex-5-ynyl-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-hex-5-ynyl-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 114158536 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | N-hex-5-ynyl-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | C#CCCCCNC1CCCc2cccnc21 |
| InChI | InChI=1S/C15H20N2/c1-2-3-4-5-11-16-14-10-6-8-13-9-7-12-17-15(13)14/h1,7,9,12,14,16H,3-6,8,10-11H2 |
| InChIKey | DKMMQFMRRDWMKN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|