C23H37N3O4 — CID 69157433
tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(5,6,7,8-tetrahydroquinolin-8-ylamino)pentanoate (PubChem CID 69157433) has the molecular formula C23H37N3O4 and a molecular weight of 419.57 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(5,6,7,8-tetrahydroquinolin-8-ylamino)pentanoate.
| Compound Name | tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(5,6,7,8-tetrahydroquinolin-8-ylamino)pentanoate |
|---|---|
| PubChem CID | 69157433 |
| Molecular Formula | C23H37N3O4 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-(5,6,7,8-tetrahydroquinolin-8-ylamino)pentanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCNC1CCCc2cccnc21)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H37N3O4/c1-22(2,3)29-20(27)18(26-21(28)30-23(4,5)6)13-9-14-24-17-12-7-10-16-11-8-15-25-19(16)17/h8,11,15,17-18,24H,7,9-10,12-14H2,1-6H3,(H,26,28)/t17?,18-/m0/s1 |
| InChIKey | BNLPSRYEILAMDF-ZVAWYAOSSA-N |
| XLogP | 4.06 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|