C27H38N4O3 — CID 158127617
tert-butyl (7S)-8-oxo-8-(pyridin-2-ylmethylamino)-7-(5,6,7,8-tetrahydroquinolin-8-ylamino)octanoate (PubChem CID 158127617) has the molecular formula C27H38N4O3 and a molecular weight of 466.63 g/mol. Its IUPAC name is tert-butyl (7S)-8-oxo-8-(pyridin-2-ylmethylamino)-7-(5,6,7,8-tetrahydroquinolin-8-ylamino)octanoate.
| Compound Name | tert-butyl (7S)-8-oxo-8-(pyridin-2-ylmethylamino)-7-(5,6,7,8-tetrahydroquinolin-8-ylamino)octanoate |
|---|---|
| PubChem CID | 158127617 |
| Molecular Formula | C27H38N4O3 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | tert-butyl (7S)-8-oxo-8-(pyridin-2-ylmethylamino)-7-(5,6,7,8-tetrahydroquinolin-8-ylamino)octanoate |
| SMILES | CC(C)(C)OC(=O)CCCCC[C@H](NC1CCCc2cccnc21)C(=O)NCc1ccccn1 |
| InChI | InChI=1S/C27H38N4O3/c1-27(2,3)34-24(32)16-6-4-5-14-23(26(33)30-19-21-13-7-8-17-28-21)31-22-15-9-11-20-12-10-18-29-25(20)22/h7-8,10,12-13,17-18,22-23,31H,4-6,9,11,14-16,19H2,1-3H3,(H,30,33)/t22?,23-/m0/s1 |
| InChIKey | WOODFCSBERJOEL-WCSIJFPASA-N |
| XLogP | 4.42 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|