C12H18N2 — CID 19851779
3-(5,6,7,8-tetrahydroquinolin-8-yl)propan-1-amine (PubChem CID 19851779) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 3-(5,6,7,8-tetrahydroquinolin-8-yl)propan-1-amine.
| Compound Name | 3-(5,6,7,8-tetrahydroquinolin-8-yl)propan-1-amine |
|---|---|
| PubChem CID | 19851779 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 3-(5,6,7,8-tetrahydroquinolin-8-yl)propan-1-amine |
| SMILES | NCCCC1CCCc2cccnc21 |
| InChI | InChI=1S/C12H18N2/c13-8-2-6-10-4-1-5-11-7-3-9-14-12(10)11/h3,7,9-10H,1-2,4-6,8,13H2 |
| InChIKey | INYNBVMGVKETPL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |