C11H13NO — CID 93476901
2-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]acetaldehyde (PubChem CID 93476901) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]acetaldehyde.
| Compound Name | 2-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]acetaldehyde |
|---|---|
| PubChem CID | 93476901 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]acetaldehyde |
| SMILES | O=CC[C@@H]1CCCc2cccnc21 |
| InChI | InChI=1S/C11H13NO/c13-8-6-10-4-1-3-9-5-2-7-12-11(9)10/h2,5,7-8,10H,1,3-4,6H2/t10-/m0/s1 |
| InChIKey | BYPAKEJMRWVZRB-JTQLQIEISA-N |
| XLogP | 2.09 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|